C14H14F3N5 — CID 142467925
N'-hydrazinyl-2-[3-(trifluoromethyl)anilino]benzenecarboximidamide (PubChem CID 142467925) has the molecular formula C14H14F3N5 and a molecular weight of 309.30 g/mol. Its IUPAC name is N'-hydrazinyl-2-[3-(trifluoromethyl)anilino]benzenecarboximidamide.
| Compound Name | N'-hydrazinyl-2-[3-(trifluoromethyl)anilino]benzenecarboximidamide |
|---|---|
| PubChem CID | 142467925 |
| Molecular Formula | C14H14F3N5 |
| Molecular Weight | 309.30 g/mol |
| Exact Mass | 309.12 |
| IUPAC Name | N'-hydrazinyl-2-[3-(trifluoromethyl)anilino]benzenecarboximidamide |
| SMILES | NN/N=C(\N)c1ccccc1Nc1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C14H14F3N5/c15-14(16,17)9-4-3-5-10(8-9)20-12-7-2-1-6-11(12)13(18)21-22-19/h1-8,20,22H,19H2,(H2,18,21) |
| InChIKey | WYPQPNLYTWMLCR-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 88.46 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.30 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|