C16H19F4N5 — CID 142468279
ethane;3-fluoro-N'-hydrazinyl-2-[4-(trifluoromethyl)anilino]benzenecarboximidamide (PubChem CID 142468279) has the molecular formula C16H19F4N5 and a molecular weight of 357.36 g/mol. Its IUPAC name is ethane;3-fluoro-N'-hydrazinyl-2-[4-(trifluoromethyl)anilino]benzenecarboximidamide.
| Compound Name | ethane;3-fluoro-N'-hydrazinyl-2-[4-(trifluoromethyl)anilino]benzenecarboximidamide |
|---|---|
| PubChem CID | 142468279 |
| Molecular Formula | C16H19F4N5 |
| Molecular Weight | 357.36 g/mol |
| Exact Mass | 357.16 |
| IUPAC Name | ethane;3-fluoro-N'-hydrazinyl-2-[4-(trifluoromethyl)anilino]benzenecarboximidamide |
| SMILES | CC.NN/N=C(\N)c1cccc(F)c1Nc1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C14H13F4N5.C2H6/c15-11-3-1-2-10(13(19)22-23-20)12(11)21-9-6-4-8(5-7-9)14(16,17)18;1-2/h1-7,21,23H,20H2,(H2,19,22);1-2H3 |
| InChIKey | QPUQKINNGABQDI-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 88.46 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.36 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|