C16H22F2N6 — CID 142468138
2-[4-(1,1-difluoroethyl)anilino]-N'-hydrazinylpyridine-3-carboximidamide;ethane (PubChem CID 142468138) has the molecular formula C16H22F2N6 and a molecular weight of 336.39 g/mol. Its IUPAC name is 2-[4-(1,1-difluoroethyl)anilino]-N'-hydrazinylpyridine-3-carboximidamide;ethane.
| Compound Name | 2-[4-(1,1-difluoroethyl)anilino]-N'-hydrazinylpyridine-3-carboximidamide;ethane |
|---|---|
| PubChem CID | 142468138 |
| Molecular Formula | C16H22F2N6 |
| Molecular Weight | 336.39 g/mol |
| Exact Mass | 336.19 |
| IUPAC Name | 2-[4-(1,1-difluoroethyl)anilino]-N'-hydrazinylpyridine-3-carboximidamide;ethane |
| SMILES | CC.CC(F)(F)c1ccc(Nc2ncccc2/C(N)=N/NN)cc1 |
| InChI | InChI=1S/C14H16F2N6.C2H6/c1-14(15,16)9-4-6-10(7-5-9)20-13-11(3-2-8-19-13)12(17)21-22-18;1-2/h2-8,22H,18H2,1H3,(H2,17,21)(H,19,20);1-2H3 |
| InChIKey | BLEFVFGIVRXPNB-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 101.35 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.39 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|