C12H12F3N7O — CID 142468337
N'-hydrazinyl-4-[4-(trifluoromethoxy)anilino]pyrimidine-5-carboximidamide (PubChem CID 142468337) has the molecular formula C12H12F3N7O and a molecular weight of 327.27 g/mol. Its IUPAC name is N'-hydrazinyl-4-[4-(trifluoromethoxy)anilino]pyrimidine-5-carboximidamide.
| Compound Name | N'-hydrazinyl-4-[4-(trifluoromethoxy)anilino]pyrimidine-5-carboximidamide |
|---|---|
| PubChem CID | 142468337 |
| Molecular Formula | C12H12F3N7O |
| Molecular Weight | 327.27 g/mol |
| Exact Mass | 327.11 |
| IUPAC Name | N'-hydrazinyl-4-[4-(trifluoromethoxy)anilino]pyrimidine-5-carboximidamide |
| SMILES | NN/N=C(\N)c1cncnc1Nc1ccc(OC(F)(F)F)cc1 |
| InChI | InChI=1S/C12H12F3N7O/c13-12(14,15)23-8-3-1-7(2-4-8)20-11-9(5-18-6-19-11)10(16)21-22-17/h1-6,22H,17H2,(H2,16,21)(H,18,19,20) |
| InChIKey | YVUDGNWXSBFLMT-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 123.47 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.27 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|