C17H13F3N6O3 — CID 22538256
4-N-(5-methyl-2-pyridinyl)-5-nitro-6-N-[4-(trifluoromethoxy)phenyl]pyrimidine-4,6-diamine (PubChem CID 22538256) has the molecular formula C17H13F3N6O3 and a molecular weight of 406.32 g/mol. Its IUPAC name is 4-N-(5-methyl-2-pyridinyl)-5-nitro-6-N-[4-(trifluoromethoxy)phenyl]pyrimidine-4,6-diamine.
| Compound Name | 4-N-(5-methyl-2-pyridinyl)-5-nitro-6-N-[4-(trifluoromethoxy)phenyl]pyrimidine-4,6-diamine |
|---|---|
| PubChem CID | 22538256 |
| Molecular Formula | C17H13F3N6O3 |
| Molecular Weight | 406.32 g/mol |
| Exact Mass | 406.10 |
| IUPAC Name | 4-N-(5-methyl-2-pyridinyl)-5-nitro-6-N-[4-(trifluoromethoxy)phenyl]pyrimidine-4,6-diamine |
| SMILES | Cc1ccc(Nc2ncnc(Nc3ccc(OC(F)(F)F)cc3)c2[N+](=O)[O-])nc1 |
| InChI | InChI=1S/C17H13F3N6O3/c1-10-2-7-13(21-8-10)25-16-14(26(27)28)15(22-9-23-16)24-11-3-5-12(6-4-11)29-17(18,19)20/h2-9H,1H3,(H2,21,22,23,24,25) |
| InChIKey | KFRWLVZZBBVLCQ-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 115.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.32 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|