C16H13ClN6O2 — CID 22533008
6-N-(4-chlorophenyl)-4-N-(5-methyl-2-pyridinyl)-5-nitropyrimidine-4,6-diamine (PubChem CID 22533008) has the molecular formula C16H13ClN6O2 and a molecular weight of 356.77 g/mol. Its IUPAC name is 6-N-(4-chlorophenyl)-4-N-(5-methyl-2-pyridinyl)-5-nitropyrimidine-4,6-diamine.
| Compound Name | 6-N-(4-chlorophenyl)-4-N-(5-methyl-2-pyridinyl)-5-nitropyrimidine-4,6-diamine |
|---|---|
| PubChem CID | 22533008 |
| Molecular Formula | C16H13ClN6O2 |
| Molecular Weight | 356.77 g/mol |
| Exact Mass | 356.08 |
| IUPAC Name | 6-N-(4-chlorophenyl)-4-N-(5-methyl-2-pyridinyl)-5-nitropyrimidine-4,6-diamine |
| SMILES | Cc1ccc(Nc2ncnc(Nc3ccc(Cl)cc3)c2[N+](=O)[O-])nc1 |
| InChI | InChI=1S/C16H13ClN6O2/c1-10-2-7-13(18-8-10)22-16-14(23(24)25)15(19-9-20-16)21-12-5-3-11(17)4-6-12/h2-9H,1H3,(H2,18,19,20,21,22) |
| InChIKey | JJJBZTBZRPRBHY-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 105.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.77 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|