C19H19ClN6O3 — CID 23495103
6-N-(4-butoxyphenyl)-4-N-(5-chloro-2-pyridinyl)-5-nitropyrimidine-4,6-diamine (PubChem CID 23495103) has the molecular formula C19H19ClN6O3 and a molecular weight of 414.85 g/mol. Its IUPAC name is 6-N-(4-butoxyphenyl)-4-N-(5-chloro-2-pyridinyl)-5-nitropyrimidine-4,6-diamine.
| Compound Name | 6-N-(4-butoxyphenyl)-4-N-(5-chloro-2-pyridinyl)-5-nitropyrimidine-4,6-diamine |
|---|---|
| PubChem CID | 23495103 |
| Molecular Formula | C19H19ClN6O3 |
| Molecular Weight | 414.85 g/mol |
| Exact Mass | 414.12 |
| IUPAC Name | 6-N-(4-butoxyphenyl)-4-N-(5-chloro-2-pyridinyl)-5-nitropyrimidine-4,6-diamine |
| SMILES | CCCCOc1ccc(Nc2ncnc(Nc3ccc(Cl)cn3)c2[N+](=O)[O-])cc1 |
| InChI | InChI=1S/C19H19ClN6O3/c1-2-3-10-29-15-7-5-14(6-8-15)24-18-17(26(27)28)19(23-12-22-18)25-16-9-4-13(20)11-21-16/h4-9,11-12H,2-3,10H2,1H3,(H2,21,22,23,24,25) |
| InChIKey | XUMNFUQTNKDCAW-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 115.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.85 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|