C21H22ClN5O3 — CID 23495137
4-N-(4-butoxyphenyl)-6-N-[(4-chlorophenyl)methyl]-5-nitropyrimidine-4,6-diamine (PubChem CID 23495137) has the molecular formula C21H22ClN5O3 and a molecular weight of 427.89 g/mol. Its IUPAC name is 4-N-(4-butoxyphenyl)-6-N-[(4-chlorophenyl)methyl]-5-nitropyrimidine-4,6-diamine.
| Compound Name | 4-N-(4-butoxyphenyl)-6-N-[(4-chlorophenyl)methyl]-5-nitropyrimidine-4,6-diamine |
|---|---|
| PubChem CID | 23495137 |
| Molecular Formula | C21H22ClN5O3 |
| Molecular Weight | 427.89 g/mol |
| Exact Mass | 427.14 |
| IUPAC Name | 4-N-(4-butoxyphenyl)-6-N-[(4-chlorophenyl)methyl]-5-nitropyrimidine-4,6-diamine |
| SMILES | CCCCOc1ccc(Nc2ncnc(NCc3ccc(Cl)cc3)c2[N+](=O)[O-])cc1 |
| InChI | InChI=1S/C21H22ClN5O3/c1-2-3-12-30-18-10-8-17(9-11-18)26-21-19(27(28)29)20(24-14-25-21)23-13-15-4-6-16(22)7-5-15/h4-11,14H,2-3,12-13H2,1H3,(H2,23,24,25,26) |
| InChIKey | YJAGHZVUSBQQMR-UHFFFAOYSA-N |
| XLogP | 5.57 |
| TPSA | 102.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.89 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|