C20H18ClF3N6O3 — CID 23495222
6-N-(4-butoxyphenyl)-4-N-[3-chloro-5-(trifluoromethyl)-2-pyridinyl]-5-nitropyrimidine-4,6-diamine (PubChem CID 23495222) has the molecular formula C20H18ClF3N6O3 and a molecular weight of 482.85 g/mol. Its IUPAC name is 6-N-(4-butoxyphenyl)-4-N-[3-chloro-5-(trifluoromethyl)-2-pyridinyl]-5-nitropyrimidine-4,6-diamine.
| Compound Name | 6-N-(4-butoxyphenyl)-4-N-[3-chloro-5-(trifluoromethyl)-2-pyridinyl]-5-nitropyrimidine-4,6-diamine |
|---|---|
| PubChem CID | 23495222 |
| Molecular Formula | C20H18ClF3N6O3 |
| Molecular Weight | 482.85 g/mol |
| Exact Mass | 482.11 |
| IUPAC Name | 6-N-(4-butoxyphenyl)-4-N-[3-chloro-5-(trifluoromethyl)-2-pyridinyl]-5-nitropyrimidine-4,6-diamine |
| SMILES | CCCCOc1ccc(Nc2ncnc(Nc3ncc(C(F)(F)F)cc3Cl)c2[N+](=O)[O-])cc1 |
| InChI | InChI=1S/C20H18ClF3N6O3/c1-2-3-8-33-14-6-4-13(5-7-14)28-18-16(30(31)32)19(27-11-26-18)29-17-15(21)9-12(10-25-17)20(22,23)24/h4-7,9-11H,2-3,8H2,1H3,(H2,25,26,27,28,29) |
| InChIKey | FDDYWEDXOAQOBY-UHFFFAOYSA-N |
| XLogP | 6.12 |
| TPSA | 115.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.85 |
| LogP ≤ 5 | 6.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|