C21H20ClN7O6 — CID 23495153
N'-[6-(4-butoxyanilino)-5-nitropyrimidin-4-yl]-4-chloro-3-nitrobenzohydrazide (PubChem CID 23495153) has the molecular formula C21H20ClN7O6 and a molecular weight of 501.89 g/mol. Its IUPAC name is N'-[6-(4-butoxyanilino)-5-nitropyrimidin-4-yl]-4-chloro-3-nitrobenzohydrazide.
| Compound Name | N'-[6-(4-butoxyanilino)-5-nitropyrimidin-4-yl]-4-chloro-3-nitrobenzohydrazide |
|---|---|
| PubChem CID | 23495153 |
| Molecular Formula | C21H20ClN7O6 |
| Molecular Weight | 501.89 g/mol |
| Exact Mass | 501.12 |
| IUPAC Name | N'-[6-(4-butoxyanilino)-5-nitropyrimidin-4-yl]-4-chloro-3-nitrobenzohydrazide |
| SMILES | CCCCOc1ccc(Nc2ncnc(NNC(=O)c3ccc(Cl)c([N+](=O)[O-])c3)c2[N+](=O)[O-])cc1 |
| InChI | InChI=1S/C21H20ClN7O6/c1-2-3-10-35-15-7-5-14(6-8-15)25-19-18(29(33)34)20(24-12-23-19)26-27-21(30)13-4-9-16(22)17(11-13)28(31)32/h4-9,11-12H,2-3,10H2,1H3,(H,27,30)(H2,23,24,25,26) |
| InChIKey | DKJFKDGSUPCPFY-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 174.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.89 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|