C20H21N7O4 — CID 23495159
N'-[6-(4-butoxyanilino)-5-nitropyrimidin-4-yl]pyridine-2-carbohydrazide (PubChem CID 23495159) has the molecular formula C20H21N7O4 and a molecular weight of 423.43 g/mol. Its IUPAC name is N'-[6-(4-butoxyanilino)-5-nitropyrimidin-4-yl]pyridine-2-carbohydrazide.
| Compound Name | N'-[6-(4-butoxyanilino)-5-nitropyrimidin-4-yl]pyridine-2-carbohydrazide |
|---|---|
| PubChem CID | 23495159 |
| Molecular Formula | C20H21N7O4 |
| Molecular Weight | 423.43 g/mol |
| Exact Mass | 423.17 |
| IUPAC Name | N'-[6-(4-butoxyanilino)-5-nitropyrimidin-4-yl]pyridine-2-carbohydrazide |
| SMILES | CCCCOc1ccc(Nc2ncnc(NNC(=O)c3ccccn3)c2[N+](=O)[O-])cc1 |
| InChI | InChI=1S/C20H21N7O4/c1-2-3-12-31-15-9-7-14(8-10-15)24-18-17(27(29)30)19(23-13-22-18)25-26-20(28)16-6-4-5-11-21-16/h4-11,13H,2-3,12H2,1H3,(H,26,28)(H2,22,23,24,25) |
| InChIKey | WFYKBJDDDIKSLH-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 144.20 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.43 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|