C10H7ClN6O3 — CID 23477377
N'-(6-chloro-5-nitropyrimidin-4-yl)pyridine-2-carbohydrazide (PubChem CID 23477377) has the molecular formula C10H7ClN6O3 and a molecular weight of 294.66 g/mol. Its IUPAC name is N'-(6-chloro-5-nitropyrimidin-4-yl)pyridine-2-carbohydrazide.
| Compound Name | N'-(6-chloro-5-nitropyrimidin-4-yl)pyridine-2-carbohydrazide |
|---|---|
| PubChem CID | 23477377 |
| Molecular Formula | C10H7ClN6O3 |
| Molecular Weight | 294.66 g/mol |
| Exact Mass | 294.03 |
| IUPAC Name | N'-(6-chloro-5-nitropyrimidin-4-yl)pyridine-2-carbohydrazide |
| SMILES | O=C(NNc1ncnc(Cl)c1[N+](=O)[O-])c1ccccn1 |
| InChI | InChI=1S/C10H7ClN6O3/c11-8-7(17(19)20)9(14-5-13-8)15-16-10(18)6-3-1-2-4-12-6/h1-5H,(H,16,18)(H,13,14,15) |
| InChIKey | FCLNPWYYGTUIGP-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 122.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.66 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|