C16H11Cl2N7O3 — CID 22534144
N'-[6-(2,4-dichloroanilino)-5-nitropyrimidin-4-yl]pyridine-2-carbohydrazide (PubChem CID 22534144) has the molecular formula C16H11Cl2N7O3 and a molecular weight of 420.22 g/mol. Its IUPAC name is N'-[6-(2,4-dichloroanilino)-5-nitropyrimidin-4-yl]pyridine-2-carbohydrazide.
| Compound Name | N'-[6-(2,4-dichloroanilino)-5-nitropyrimidin-4-yl]pyridine-2-carbohydrazide |
|---|---|
| PubChem CID | 22534144 |
| Molecular Formula | C16H11Cl2N7O3 |
| Molecular Weight | 420.22 g/mol |
| Exact Mass | 419.03 |
| IUPAC Name | N'-[6-(2,4-dichloroanilino)-5-nitropyrimidin-4-yl]pyridine-2-carbohydrazide |
| SMILES | O=C(NNc1ncnc(Nc2ccc(Cl)cc2Cl)c1[N+](=O)[O-])c1ccccn1 |
| InChI | InChI=1S/C16H11Cl2N7O3/c17-9-4-5-11(10(18)7-9)22-14-13(25(27)28)15(21-8-20-14)23-24-16(26)12-3-1-2-6-19-12/h1-8H,(H,24,26)(H2,20,21,22,23) |
| InChIKey | DIEFTPPADCISNP-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 134.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.22 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|