C16H10Cl3N5O2 — CID 22530775
6-N-(2-chlorophenyl)-4-N-(2,5-dichlorophenyl)-5-nitropyrimidine-4,6-diamine (PubChem CID 22530775) has the molecular formula C16H10Cl3N5O2 and a molecular weight of 410.65 g/mol. Its IUPAC name is 6-N-(2-chlorophenyl)-4-N-(2,5-dichlorophenyl)-5-nitropyrimidine-4,6-diamine.
| Compound Name | 6-N-(2-chlorophenyl)-4-N-(2,5-dichlorophenyl)-5-nitropyrimidine-4,6-diamine |
|---|---|
| PubChem CID | 22530775 |
| Molecular Formula | C16H10Cl3N5O2 |
| Molecular Weight | 410.65 g/mol |
| Exact Mass | 408.99 |
| IUPAC Name | 6-N-(2-chlorophenyl)-4-N-(2,5-dichlorophenyl)-5-nitropyrimidine-4,6-diamine |
| SMILES | O=[N+]([O-])c1c(Nc2ccccc2Cl)ncnc1Nc1cc(Cl)ccc1Cl |
| InChI | InChI=1S/C16H10Cl3N5O2/c17-9-5-6-11(19)13(7-9)23-16-14(24(25)26)15(20-8-21-16)22-12-4-2-1-3-10(12)18/h1-8H,(H2,20,21,22,23) |
| InChIKey | CMRFJBUJTILKDH-UHFFFAOYSA-N |
| XLogP | 5.83 |
| TPSA | 92.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.65 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|