C16H20N8O3 — CID 23490358
N'-[6-(4-ethylpiperazin-1-yl)-5-nitropyrimidin-4-yl]pyridine-2-carbohydrazide (PubChem CID 23490358) has the molecular formula C16H20N8O3 and a molecular weight of 372.39 g/mol. Its IUPAC name is N'-[6-(4-ethylpiperazin-1-yl)-5-nitropyrimidin-4-yl]pyridine-2-carbohydrazide.
| Compound Name | N'-[6-(4-ethylpiperazin-1-yl)-5-nitropyrimidin-4-yl]pyridine-2-carbohydrazide |
|---|---|
| PubChem CID | 23490358 |
| Molecular Formula | C16H20N8O3 |
| Molecular Weight | 372.39 g/mol |
| Exact Mass | 372.17 |
| IUPAC Name | N'-[6-(4-ethylpiperazin-1-yl)-5-nitropyrimidin-4-yl]pyridine-2-carbohydrazide |
| SMILES | CCN1CCN(c2ncnc(NNC(=O)c3ccccn3)c2[N+](=O)[O-])CC1 |
| InChI | InChI=1S/C16H20N8O3/c1-2-22-7-9-23(10-8-22)15-13(24(26)27)14(18-11-19-15)20-21-16(25)12-5-3-4-6-17-12/h3-6,11H,2,7-10H2,1H3,(H,21,25)(H,18,19,20) |
| InChIKey | FYQSHANPSMPKBM-UHFFFAOYSA-N |
| XLogP | 0.68 |
| TPSA | 129.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.39 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|