C15H19N7O4 — CID 23490359
N'-[6-(4-ethylpiperazin-1-yl)-5-nitropyrimidin-4-yl]furan-2-carbohydrazide (PubChem CID 23490359) has the molecular formula C15H19N7O4 and a molecular weight of 361.36 g/mol. Its IUPAC name is N'-[6-(4-ethylpiperazin-1-yl)-5-nitropyrimidin-4-yl]furan-2-carbohydrazide.
| Compound Name | N'-[6-(4-ethylpiperazin-1-yl)-5-nitropyrimidin-4-yl]furan-2-carbohydrazide |
|---|---|
| PubChem CID | 23490359 |
| Molecular Formula | C15H19N7O4 |
| Molecular Weight | 361.36 g/mol |
| Exact Mass | 361.15 |
| IUPAC Name | N'-[6-(4-ethylpiperazin-1-yl)-5-nitropyrimidin-4-yl]furan-2-carbohydrazide |
| SMILES | CCN1CCN(c2ncnc(NNC(=O)c3ccco3)c2[N+](=O)[O-])CC1 |
| InChI | InChI=1S/C15H19N7O4/c1-2-20-5-7-21(8-6-20)14-12(22(24)25)13(16-10-17-14)18-19-15(23)11-4-3-9-26-11/h3-4,9-10H,2,5-8H2,1H3,(H,19,23)(H,16,17,18) |
| InChIKey | NQBUJGMQEFCADC-UHFFFAOYSA-N |
| XLogP | 0.88 |
| TPSA | 129.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.36 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|