C13H14N6O5 — CID 23489620
N'-(6-morpholin-4-yl-5-nitropyrimidin-4-yl)furan-2-carbohydrazide (PubChem CID 23489620) has the molecular formula C13H14N6O5 and a molecular weight of 334.29 g/mol. Its IUPAC name is N'-(6-morpholin-4-yl-5-nitropyrimidin-4-yl)furan-2-carbohydrazide.
| Compound Name | N'-(6-morpholin-4-yl-5-nitropyrimidin-4-yl)furan-2-carbohydrazide |
|---|---|
| PubChem CID | 23489620 |
| Molecular Formula | C13H14N6O5 |
| Molecular Weight | 334.29 g/mol |
| Exact Mass | 334.10 |
| IUPAC Name | N'-(6-morpholin-4-yl-5-nitropyrimidin-4-yl)furan-2-carbohydrazide |
| SMILES | O=C(NNc1ncnc(N2CCOCC2)c1[N+](=O)[O-])c1ccco1 |
| InChI | InChI=1S/C13H14N6O5/c20-13(9-2-1-5-24-9)17-16-11-10(19(21)22)12(15-8-14-11)18-3-6-23-7-4-18/h1-2,5,8H,3-4,6-7H2,(H,17,20)(H,14,15,16) |
| InChIKey | PINOIZGWENNFIG-UHFFFAOYSA-N |
| XLogP | 0.57 |
| TPSA | 135.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.29 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|