C14H15N7O4 — CID 23489617
N'-(6-morpholin-4-yl-5-nitropyrimidin-4-yl)pyridine-4-carbohydrazide (PubChem CID 23489617) has the molecular formula C14H15N7O4 and a molecular weight of 345.32 g/mol. Its IUPAC name is N'-(6-morpholin-4-yl-5-nitropyrimidin-4-yl)pyridine-4-carbohydrazide.
| Compound Name | N'-(6-morpholin-4-yl-5-nitropyrimidin-4-yl)pyridine-4-carbohydrazide |
|---|---|
| PubChem CID | 23489617 |
| Molecular Formula | C14H15N7O4 |
| Molecular Weight | 345.32 g/mol |
| Exact Mass | 345.12 |
| IUPAC Name | N'-(6-morpholin-4-yl-5-nitropyrimidin-4-yl)pyridine-4-carbohydrazide |
| SMILES | O=C(NNc1ncnc(N2CCOCC2)c1[N+](=O)[O-])c1ccncc1 |
| InChI | InChI=1S/C14H15N7O4/c22-14(10-1-3-15-4-2-10)19-18-12-11(21(23)24)13(17-9-16-12)20-5-7-25-8-6-20/h1-4,9H,5-8H2,(H,19,22)(H,16,17,18) |
| InChIKey | KDTRIOSTAAHREF-UHFFFAOYSA-N |
| XLogP | 0.37 |
| TPSA | 135.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.32 |
| LogP ≤ 5 | 0.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|