C21H19BrFN7O3 — CID 22535480
4-bromo-N'-[6-[4-(4-fluorophenyl)piperazin-1-yl]-5-nitropyrimidin-4-yl]benzohydrazide (PubChem CID 22535480) has the molecular formula C21H19BrFN7O3 and a molecular weight of 516.33 g/mol. Its IUPAC name is 4-bromo-N'-[6-[4-(4-fluorophenyl)piperazin-1-yl]-5-nitropyrimidin-4-yl]benzohydrazide.
| Compound Name | 4-bromo-N'-[6-[4-(4-fluorophenyl)piperazin-1-yl]-5-nitropyrimidin-4-yl]benzohydrazide |
|---|---|
| PubChem CID | 22535480 |
| Molecular Formula | C21H19BrFN7O3 |
| Molecular Weight | 516.33 g/mol |
| Exact Mass | 515.07 |
| IUPAC Name | 4-bromo-N'-[6-[4-(4-fluorophenyl)piperazin-1-yl]-5-nitropyrimidin-4-yl]benzohydrazide |
| SMILES | O=C(NNc1ncnc(N2CCN(c3ccc(F)cc3)CC2)c1[N+](=O)[O-])c1ccc(Br)cc1 |
| InChI | InChI=1S/C21H19BrFN7O3/c22-15-3-1-14(2-4-15)21(31)27-26-19-18(30(32)33)20(25-13-24-19)29-11-9-28(10-12-29)17-7-5-16(23)6-8-17/h1-8,13H,9-12H2,(H,27,31)(H,24,25,26) |
| InChIKey | PKTJJERLIMVQOC-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 116.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.33 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|