C18H24FN7O2 — CID 22537549
1-tert-butyl-2-[6-[4-(4-fluorophenyl)piperazin-1-yl]-5-nitropyrimidin-4-yl]hydrazine (PubChem CID 22537549) has the molecular formula C18H24FN7O2 and a molecular weight of 389.44 g/mol. Its IUPAC name is 1-tert-butyl-2-[6-[4-(4-fluorophenyl)piperazin-1-yl]-5-nitropyrimidin-4-yl]hydrazine.
| Compound Name | 1-tert-butyl-2-[6-[4-(4-fluorophenyl)piperazin-1-yl]-5-nitropyrimidin-4-yl]hydrazine |
|---|---|
| PubChem CID | 22537549 |
| Molecular Formula | C18H24FN7O2 |
| Molecular Weight | 389.44 g/mol |
| Exact Mass | 389.20 |
| IUPAC Name | 1-tert-butyl-2-[6-[4-(4-fluorophenyl)piperazin-1-yl]-5-nitropyrimidin-4-yl]hydrazine |
| SMILES | CC(C)(C)NNc1ncnc(N2CCN(c3ccc(F)cc3)CC2)c1[N+](=O)[O-] |
| InChI | InChI=1S/C18H24FN7O2/c1-18(2,3)23-22-16-15(26(27)28)17(21-12-20-16)25-10-8-24(9-11-25)14-6-4-13(19)5-7-14/h4-7,12,23H,8-11H2,1-3H3,(H,20,21,22) |
| InChIKey | QCWSZHINAFVNMQ-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 99.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.44 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|