C14H15FN6O2 — CID 2959623
6-[4-(4-fluorophenyl)piperazin-1-yl]-5-nitropyrimidin-4-amine (PubChem CID 2959623) has the molecular formula C14H15FN6O2 and a molecular weight of 318.31 g/mol. Its IUPAC name is 6-[4-(4-fluorophenyl)piperazin-1-yl]-5-nitropyrimidin-4-amine.
| Compound Name | 6-[4-(4-fluorophenyl)piperazin-1-yl]-5-nitropyrimidin-4-amine |
|---|---|
| PubChem CID | 2959623 |
| Molecular Formula | C14H15FN6O2 |
| Molecular Weight | 318.31 g/mol |
| Exact Mass | 318.12 |
| IUPAC Name | 6-[4-(4-fluorophenyl)piperazin-1-yl]-5-nitropyrimidin-4-amine |
| SMILES | Nc1ncnc(N2CCN(c3ccc(F)cc3)CC2)c1[N+](=O)[O-] |
| InChI | InChI=1S/C14H15FN6O2/c15-10-1-3-11(4-2-10)19-5-7-20(8-6-19)14-12(21(22)23)13(16)17-9-18-14/h1-4,9H,5-8H2,(H2,16,17,18) |
| InChIKey | PEMWNMQNBLUTLO-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 101.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.31 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|