C14H17FN6 — CID 19137206
6-[4-(4-fluorophenyl)piperazin-1-yl]pyrimidine-4,5-diamine (PubChem CID 19137206) has the molecular formula C14H17FN6 and a molecular weight of 288.33 g/mol. Its IUPAC name is 6-[4-(4-fluorophenyl)piperazin-1-yl]pyrimidine-4,5-diamine.
| Compound Name | 6-[4-(4-fluorophenyl)piperazin-1-yl]pyrimidine-4,5-diamine |
|---|---|
| PubChem CID | 19137206 |
| Molecular Formula | C14H17FN6 |
| Molecular Weight | 288.33 g/mol |
| Exact Mass | 288.15 |
| IUPAC Name | 6-[4-(4-fluorophenyl)piperazin-1-yl]pyrimidine-4,5-diamine |
| SMILES | Nc1ncnc(N2CCN(c3ccc(F)cc3)CC2)c1N |
| InChI | InChI=1S/C14H17FN6/c15-10-1-3-11(4-2-10)20-5-7-21(8-6-20)14-12(16)13(17)18-9-19-14/h1-4,9H,5-8,16H2,(H2,17,18,19) |
| InChIKey | UNFVFAAWITYTOK-UHFFFAOYSA-N |
| XLogP | 1.11 |
| TPSA | 84.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.33 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |