C21H29FN6 — CID 19140549
4-(2-ethylpiperidin-1-yl)-6-[4-(4-fluorophenyl)piperazin-1-yl]pyrimidin-5-amine (PubChem CID 19140549) has the molecular formula C21H29FN6 and a molecular weight of 384.50 g/mol. Its IUPAC name is 4-(2-ethylpiperidin-1-yl)-6-[4-(4-fluorophenyl)piperazin-1-yl]pyrimidin-5-amine.
| Compound Name | 4-(2-ethylpiperidin-1-yl)-6-[4-(4-fluorophenyl)piperazin-1-yl]pyrimidin-5-amine |
|---|---|
| PubChem CID | 19140549 |
| Molecular Formula | C21H29FN6 |
| Molecular Weight | 384.50 g/mol |
| Exact Mass | 384.24 |
| IUPAC Name | 4-(2-ethylpiperidin-1-yl)-6-[4-(4-fluorophenyl)piperazin-1-yl]pyrimidin-5-amine |
| SMILES | CCC1CCCCN1c1ncnc(N2CCN(c3ccc(F)cc3)CC2)c1N |
| InChI | InChI=1S/C21H29FN6/c1-2-17-5-3-4-10-28(17)21-19(23)20(24-15-25-21)27-13-11-26(12-14-27)18-8-6-16(22)7-9-18/h6-9,15,17H,2-5,10-14,23H2,1H3 |
| InChIKey | BPCLQRABHAWSLD-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 61.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.50 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |