C19H26N4O — CID 19140572
4-(3,4-dimethylphenoxy)-6-(2-ethylpiperidin-1-yl)pyrimidin-5-amine (PubChem CID 19140572) has the molecular formula C19H26N4O and a molecular weight of 326.44 g/mol. Its IUPAC name is 4-(3,4-dimethylphenoxy)-6-(2-ethylpiperidin-1-yl)pyrimidin-5-amine.
| Compound Name | 4-(3,4-dimethylphenoxy)-6-(2-ethylpiperidin-1-yl)pyrimidin-5-amine |
|---|---|
| PubChem CID | 19140572 |
| Molecular Formula | C19H26N4O |
| Molecular Weight | 326.44 g/mol |
| Exact Mass | 326.21 |
| IUPAC Name | 4-(3,4-dimethylphenoxy)-6-(2-ethylpiperidin-1-yl)pyrimidin-5-amine |
| SMILES | CCC1CCCCN1c1ncnc(Oc2ccc(C)c(C)c2)c1N |
| InChI | InChI=1S/C19H26N4O/c1-4-15-7-5-6-10-23(15)18-17(20)19(22-12-21-18)24-16-9-8-13(2)14(3)11-16/h8-9,11-12,15H,4-7,10,20H2,1-3H3 |
| InChIKey | VTZYPNRADOPIAV-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 64.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.44 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |