C23H27N5O — CID 19139382
4-(4-benzylpiperazin-1-yl)-6-(3,4-dimethylphenoxy)pyrimidin-5-amine (PubChem CID 19139382) has the molecular formula C23H27N5O and a molecular weight of 389.50 g/mol. Its IUPAC name is 4-(4-benzylpiperazin-1-yl)-6-(3,4-dimethylphenoxy)pyrimidin-5-amine.
| Compound Name | 4-(4-benzylpiperazin-1-yl)-6-(3,4-dimethylphenoxy)pyrimidin-5-amine |
|---|---|
| PubChem CID | 19139382 |
| Molecular Formula | C23H27N5O |
| Molecular Weight | 389.50 g/mol |
| Exact Mass | 389.22 |
| IUPAC Name | 4-(4-benzylpiperazin-1-yl)-6-(3,4-dimethylphenoxy)pyrimidin-5-amine |
| SMILES | Cc1ccc(Oc2ncnc(N3CCN(Cc4ccccc4)CC3)c2N)cc1C |
| InChI | InChI=1S/C23H27N5O/c1-17-8-9-20(14-18(17)2)29-23-21(24)22(25-16-26-23)28-12-10-27(11-13-28)15-19-6-4-3-5-7-19/h3-9,14,16H,10-13,15,24H2,1-2H3 |
| InChIKey | HMVVJHOKOXGAKH-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 67.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.50 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |