C18H22ClN5O3 — CID 19153249
ethyl 4-[5-amino-6-(4-chloro-3-methylphenoxy)pyrimidin-4-yl]piperazine-1-carboxylate (PubChem CID 19153249) has the molecular formula C18H22ClN5O3 and a molecular weight of 391.86 g/mol. Its IUPAC name is ethyl 4-[5-amino-6-(4-chloro-3-methylphenoxy)pyrimidin-4-yl]piperazine-1-carboxylate.
| Compound Name | ethyl 4-[5-amino-6-(4-chloro-3-methylphenoxy)pyrimidin-4-yl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 19153249 |
| Molecular Formula | C18H22ClN5O3 |
| Molecular Weight | 391.86 g/mol |
| Exact Mass | 391.14 |
| IUPAC Name | ethyl 4-[5-amino-6-(4-chloro-3-methylphenoxy)pyrimidin-4-yl]piperazine-1-carboxylate |
| SMILES | CCOC(=O)N1CCN(c2ncnc(Oc3ccc(Cl)c(C)c3)c2N)CC1 |
| InChI | InChI=1S/C18H22ClN5O3/c1-3-26-18(25)24-8-6-23(7-9-24)16-15(20)17(22-11-21-16)27-13-4-5-14(19)12(2)10-13/h4-5,10-11H,3,6-9,20H2,1-2H3 |
| InChIKey | MNYANGJFUDPVAZ-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 93.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.86 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |