C15H15ClN4O3 — CID 23489271
4-(4-chloro-3-methylphenoxy)-5-nitro-6-pyrrolidin-1-ylpyrimidine (PubChem CID 23489271) has the molecular formula C15H15ClN4O3 and a molecular weight of 334.76 g/mol. Its IUPAC name is 4-(4-chloro-3-methylphenoxy)-5-nitro-6-pyrrolidin-1-ylpyrimidine.
| Compound Name | 4-(4-chloro-3-methylphenoxy)-5-nitro-6-pyrrolidin-1-ylpyrimidine |
|---|---|
| PubChem CID | 23489271 |
| Molecular Formula | C15H15ClN4O3 |
| Molecular Weight | 334.76 g/mol |
| Exact Mass | 334.08 |
| IUPAC Name | 4-(4-chloro-3-methylphenoxy)-5-nitro-6-pyrrolidin-1-ylpyrimidine |
| SMILES | Cc1cc(Oc2ncnc(N3CCCC3)c2[N+](=O)[O-])ccc1Cl |
| InChI | InChI=1S/C15H15ClN4O3/c1-10-8-11(4-5-12(10)16)23-15-13(20(21)22)14(17-9-18-15)19-6-2-3-7-19/h4-5,8-9H,2-3,6-7H2,1H3 |
| InChIKey | OYXVIGBFYSQMOY-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 81.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.76 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|