C17H20ClFN6O2 — CID 19153099
ethyl 4-[5-amino-6-(3-chloro-4-fluoroanilino)pyrimidin-4-yl]piperazine-1-carboxylate (PubChem CID 19153099) has the molecular formula C17H20ClFN6O2 and a molecular weight of 394.84 g/mol. Its IUPAC name is ethyl 4-[5-amino-6-(3-chloro-4-fluoroanilino)pyrimidin-4-yl]piperazine-1-carboxylate.
| Compound Name | ethyl 4-[5-amino-6-(3-chloro-4-fluoroanilino)pyrimidin-4-yl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 19153099 |
| Molecular Formula | C17H20ClFN6O2 |
| Molecular Weight | 394.84 g/mol |
| Exact Mass | 394.13 |
| IUPAC Name | ethyl 4-[5-amino-6-(3-chloro-4-fluoroanilino)pyrimidin-4-yl]piperazine-1-carboxylate |
| SMILES | CCOC(=O)N1CCN(c2ncnc(Nc3ccc(F)c(Cl)c3)c2N)CC1 |
| InChI | InChI=1S/C17H20ClFN6O2/c1-2-27-17(26)25-7-5-24(6-8-25)16-14(20)15(21-10-22-16)23-11-3-4-13(19)12(18)9-11/h3-4,9-10H,2,5-8,20H2,1H3,(H,21,22,23) |
| InChIKey | AUEAJFIJJYVSNJ-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 96.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.84 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |