C17H14ClFN4O2S — CID 58116867
ethyl 12-(3-chloro-4-fluoroanilino)-7-thia-4,9,11-triazatricyclo[6.4.0.02,6]dodeca-1(12),2(6),8,10-tetraene-4-carboxylate (PubChem CID 58116867) has the molecular formula C17H14ClFN4O2S and a molecular weight of 392.84 g/mol. Its IUPAC name is ethyl 12-(3-chloro-4-fluoroanilino)-7-thia-4,9,11-triazatricyclo[6.4.0.02,6]dodeca-1(12),2(6),8,10-tetraene-4-carboxylate.
| Compound Name | ethyl 12-(3-chloro-4-fluoroanilino)-7-thia-4,9,11-triazatricyclo[6.4.0.02,6]dodeca-1(12),2(6),8,10-tetraene-4-carboxylate |
|---|---|
| PubChem CID | 58116867 |
| Molecular Formula | C17H14ClFN4O2S |
| Molecular Weight | 392.84 g/mol |
| Exact Mass | 392.05 |
| IUPAC Name | ethyl 12-(3-chloro-4-fluoroanilino)-7-thia-4,9,11-triazatricyclo[6.4.0.02,6]dodeca-1(12),2(6),8,10-tetraene-4-carboxylate |
| SMILES | CCOC(=O)N1Cc2sc3ncnc(Nc4ccc(F)c(Cl)c4)c3c2C1 |
| InChI | InChI=1S/C17H14ClFN4O2S/c1-2-25-17(24)23-6-10-13(7-23)26-16-14(10)15(20-8-21-16)22-9-3-4-12(19)11(18)5-9/h3-5,8H,2,6-7H2,1H3,(H,20,21,22) |
| InChIKey | KIDYRZWAUHPUBX-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 67.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.84 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |