C27H30ClFN6O3S — CID 123336651
ethyl 2-[4-[4-[3-(3-chloro-4-fluoroanilino)-8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6-tetraen-11-yl]-4-oxobut-2-enyl]piperazin-1-yl]acetate (PubChem CID 123336651) has the molecular formula C27H30ClFN6O3S and a molecular weight of 573.09 g/mol. Its IUPAC name is ethyl 2-[4-[4-[3-(3-chloro-4-fluoroanilino)-8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6-tetraen-11-yl]-4-oxobut-2-enyl]piperazin-1-yl]acetate.
| Compound Name | ethyl 2-[4-[4-[3-(3-chloro-4-fluoroanilino)-8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6-tetraen-11-yl]-4-oxobut-2-enyl]piperazin-1-yl]acetate |
|---|---|
| PubChem CID | 123336651 |
| Molecular Formula | C27H30ClFN6O3S |
| Molecular Weight | 573.09 g/mol |
| Exact Mass | 572.18 |
| IUPAC Name | ethyl 2-[4-[4-[3-(3-chloro-4-fluoroanilino)-8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6-tetraen-11-yl]-4-oxobut-2-enyl]piperazin-1-yl]acetate |
| SMILES | CCOC(=O)CN1CCN(CC=CC(=O)N2CCc3c(sc4ncnc(Nc5ccc(F)c(Cl)c5)c34)C2)CC1 |
| InChI | InChI=1S/C27H30ClFN6O3S/c1-2-38-24(37)16-34-12-10-33(11-13-34)8-3-4-23(36)35-9-7-19-22(15-35)39-27-25(19)26(30-17-31-27)32-18-5-6-21(29)20(28)14-18/h3-6,14,17H,2,7-13,15-16H2,1H3,(H,30,31,32) |
| InChIKey | HIPFFJVLGPDCGK-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 90.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.09 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|