C23H23ClFN5OS2 — CID 66877709
1-[3-(3-chloro-4-fluoroanilino)-8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6-tetraen-11-yl]-4-thiomorpholin-4-ylbut-2-en-1-one (PubChem CID 66877709) has the molecular formula C23H23ClFN5OS2 and a molecular weight of 504.06 g/mol. Its IUPAC name is 1-[3-(3-chloro-4-fluoroanilino)-8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6-tetraen-11-yl]-4-thiomorpholin-4-ylbut-2-en-1-one.
| Compound Name | 1-[3-(3-chloro-4-fluoroanilino)-8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6-tetraen-11-yl]-4-thiomorpholin-4-ylbut-2-en-1-one |
|---|---|
| PubChem CID | 66877709 |
| Molecular Formula | C23H23ClFN5OS2 |
| Molecular Weight | 504.06 g/mol |
| Exact Mass | 503.10 |
| IUPAC Name | 1-[3-(3-chloro-4-fluoroanilino)-8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6-tetraen-11-yl]-4-thiomorpholin-4-ylbut-2-en-1-one |
| SMILES | O=C(C=CCN1CCSCC1)N1CCc2c(sc3ncnc(Nc4ccc(F)c(Cl)c4)c23)C1 |
| InChI | InChI=1S/C23H23ClFN5OS2/c24-17-12-15(3-4-18(17)25)28-22-21-16-5-7-30(13-19(16)33-23(21)27-14-26-22)20(31)2-1-6-29-8-10-32-11-9-29/h1-4,12,14H,5-11,13H2,(H,26,27,28) |
| InChIKey | AWDVQNCEQUQOHK-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.06 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|