C27H33ClFN7OS — CID 123258760
1-[3-(3-chloro-4-fluoroanilino)-8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6-tetraen-11-yl]-4-[4-[2-(dimethylamino)ethyl]piperazin-1-yl]but-2-en-1-one (PubChem CID 123258760) has the molecular formula C27H33ClFN7OS and a molecular weight of 558.13 g/mol. Its IUPAC name is 1-[3-(3-chloro-4-fluoroanilino)-8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6-tetraen-11-yl]-4-[4-[2-(dimethylamino)ethyl]piperazin-1-yl]but-2-en-1-one.
| Compound Name | 1-[3-(3-chloro-4-fluoroanilino)-8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6-tetraen-11-yl]-4-[4-[2-(dimethylamino)ethyl]piperazin-1-yl]but-2-en-1-one |
|---|---|
| PubChem CID | 123258760 |
| Molecular Formula | C27H33ClFN7OS |
| Molecular Weight | 558.13 g/mol |
| Exact Mass | 557.21 |
| IUPAC Name | 1-[3-(3-chloro-4-fluoroanilino)-8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6-tetraen-11-yl]-4-[4-[2-(dimethylamino)ethyl]piperazin-1-yl]but-2-en-1-one |
| SMILES | CN(C)CCN1CCN(CC=CC(=O)N2CCc3c(sc4ncnc(Nc5ccc(F)c(Cl)c5)c34)C2)CC1 |
| InChI | InChI=1S/C27H33ClFN7OS/c1-33(2)10-11-35-14-12-34(13-15-35)8-3-4-24(37)36-9-7-20-23(17-36)38-27-25(20)26(30-18-31-27)32-19-5-6-22(29)21(28)16-19/h3-6,16,18H,7-15,17H2,1-2H3,(H,30,31,32) |
| InChIKey | ZWBLXQFFQOJMKQ-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 67.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.13 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|