C26H28ClFN6O2S — CID 123729844
1-[4-[3-(3-chloro-4-fluoroanilino)-8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6-tetraen-11-yl]-4-oxobut-2-enyl]-N-methylpiperidine-3-carboxamide (PubChem CID 123729844) has the molecular formula C26H28ClFN6O2S and a molecular weight of 543.07 g/mol. Its IUPAC name is 1-[4-[3-(3-chloro-4-fluoroanilino)-8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6-tetraen-11-yl]-4-oxobut-2-enyl]-N-methylpiperidine-3-carboxamide.
| Compound Name | 1-[4-[3-(3-chloro-4-fluoroanilino)-8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6-tetraen-11-yl]-4-oxobut-2-enyl]-N-methylpiperidine-3-carboxamide |
|---|---|
| PubChem CID | 123729844 |
| Molecular Formula | C26H28ClFN6O2S |
| Molecular Weight | 543.07 g/mol |
| Exact Mass | 542.17 |
| IUPAC Name | 1-[4-[3-(3-chloro-4-fluoroanilino)-8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6-tetraen-11-yl]-4-oxobut-2-enyl]-N-methylpiperidine-3-carboxamide |
| SMILES | CNC(=O)C1CCCN(CC=CC(=O)N2CCc3c(sc4ncnc(Nc5ccc(F)c(Cl)c5)c34)C2)C1 |
| InChI | InChI=1S/C26H28ClFN6O2S/c1-29-25(36)16-4-2-9-33(13-16)10-3-5-22(35)34-11-8-18-21(14-34)37-26-23(18)24(30-15-31-26)32-17-6-7-20(28)19(27)12-17/h3,5-7,12,15-16H,2,4,8-11,13-14H2,1H3,(H,29,36)(H,30,31,32) |
| InChIKey | QIPPRTYHJVWQPL-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 90.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.07 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|