C25H27ClFN5O2S — CID 59587028
(E)-1-[3-(3-chloro-4-fluoroanilino)-8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6-tetraen-11-yl]-4-(2,6-dimethylmorpholin-4-yl)but-2-en-1-one (PubChem CID 59587028) has the molecular formula C25H27ClFN5O2S and a molecular weight of 516.04 g/mol. Its IUPAC name is (E)-1-[3-(3-chloro-4-fluoroanilino)-8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6-tetraen-11-yl]-4-(2,6-dimethylmorpholin-4-yl)but-2-en-1-one.
| Compound Name | (E)-1-[3-(3-chloro-4-fluoroanilino)-8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6-tetraen-11-yl]-4-(2,6-dimethylmorpholin-4-yl)but-2-en-1-one |
|---|---|
| PubChem CID | 59587028 |
| Molecular Formula | C25H27ClFN5O2S |
| Molecular Weight | 516.04 g/mol |
| Exact Mass | 515.16 |
| IUPAC Name | (E)-1-[3-(3-chloro-4-fluoroanilino)-8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6-tetraen-11-yl]-4-(2,6-dimethylmorpholin-4-yl)but-2-en-1-one |
| SMILES | CC1CN(C/C=C/C(=O)N2CCc3c(sc4ncnc(Nc5ccc(F)c(Cl)c5)c34)C2)CC(C)O1 |
| InChI | InChI=1S/C25H27ClFN5O2S/c1-15-11-31(12-16(2)34-15)8-3-4-22(33)32-9-7-18-21(13-32)35-25-23(18)24(28-14-29-25)30-17-5-6-20(27)19(26)10-17/h3-6,10,14-16H,7-9,11-13H2,1-2H3,(H,28,29,30)/b4-3+ |
| InChIKey | NRMFSXPGSNJKGQ-ONEGZZNKSA-N |
| XLogP | 4.78 |
| TPSA | 70.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.04 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|