C26H27ClFN5OS — CID 58116826
(E)-4-(2-azabicyclo[2.2.2]octan-2-yl)-1-[3-(3-chloro-4-fluoroanilino)-8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6-tetraen-11-yl]but-2-en-1-one (PubChem CID 58116826) has the molecular formula C26H27ClFN5OS and a molecular weight of 512.05 g/mol. Its IUPAC name is (E)-4-(2-azabicyclo[2.2.2]octan-2-yl)-1-[3-(3-chloro-4-fluoroanilino)-8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6-tetraen-11-yl]but-2-en-1-one.
| Compound Name | (E)-4-(2-azabicyclo[2.2.2]octan-2-yl)-1-[3-(3-chloro-4-fluoroanilino)-8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6-tetraen-11-yl]but-2-en-1-one |
|---|---|
| PubChem CID | 58116826 |
| Molecular Formula | C26H27ClFN5OS |
| Molecular Weight | 512.05 g/mol |
| Exact Mass | 511.16 |
| IUPAC Name | (E)-4-(2-azabicyclo[2.2.2]octan-2-yl)-1-[3-(3-chloro-4-fluoroanilino)-8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6-tetraen-11-yl]but-2-en-1-one |
| SMILES | O=C(/C=C/CN1CC2CCC1CC2)N1CCc2c(sc3ncnc(Nc4ccc(F)c(Cl)c4)c23)C1 |
| InChI | InChI=1S/C26H27ClFN5OS/c27-20-12-17(5-8-21(20)28)31-25-24-19-9-11-33(14-22(19)35-26(24)30-15-29-25)23(34)2-1-10-32-13-16-3-6-18(32)7-4-16/h1-2,5,8,12,15-16,18H,3-4,6-7,9-11,13-14H2,(H,29,30,31)/b2-1+ |
| InChIKey | SFVRZOXGBGIHJL-OWOJBTEDSA-N |
| XLogP | 5.54 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.05 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|