C28H32ClFN6OS — CID 123872766
1-[3-(3-chloro-4-fluoroanilino)-8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6-tetraen-11-yl]-4-(4-cyclopentylpiperazin-1-yl)but-2-en-1-one (PubChem CID 123872766) has the molecular formula C28H32ClFN6OS and a molecular weight of 555.12 g/mol. Its IUPAC name is 1-[3-(3-chloro-4-fluoroanilino)-8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6-tetraen-11-yl]-4-(4-cyclopentylpiperazin-1-yl)but-2-en-1-one.
| Compound Name | 1-[3-(3-chloro-4-fluoroanilino)-8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6-tetraen-11-yl]-4-(4-cyclopentylpiperazin-1-yl)but-2-en-1-one |
|---|---|
| PubChem CID | 123872766 |
| Molecular Formula | C28H32ClFN6OS |
| Molecular Weight | 555.12 g/mol |
| Exact Mass | 554.20 |
| IUPAC Name | 1-[3-(3-chloro-4-fluoroanilino)-8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6-tetraen-11-yl]-4-(4-cyclopentylpiperazin-1-yl)but-2-en-1-one |
| SMILES | O=C(C=CCN1CCN(C2CCCC2)CC1)N1CCc2c(sc3ncnc(Nc4ccc(F)c(Cl)c4)c23)C1 |
| InChI | InChI=1S/C28H32ClFN6OS/c29-22-16-19(7-8-23(22)30)33-27-26-21-9-11-36(17-24(21)38-28(26)32-18-31-27)25(37)6-3-10-34-12-14-35(15-13-34)20-4-1-2-5-20/h3,6-8,16,18,20H,1-2,4-5,9-15,17H2,(H,31,32,33) |
| InChIKey | FPRLRRZLXRNBJS-UHFFFAOYSA-N |
| XLogP | 5.23 |
| TPSA | 64.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.12 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|