C26H29ClFN5OS — CID 66877451
1-[3-(3-chloro-4-fluoroanilino)-8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6-tetraen-11-yl]-4-(2,6-dimethylpiperidin-1-yl)but-2-en-1-one (PubChem CID 66877451) has the molecular formula C26H29ClFN5OS and a molecular weight of 514.07 g/mol. Its IUPAC name is 1-[3-(3-chloro-4-fluoroanilino)-8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6-tetraen-11-yl]-4-(2,6-dimethylpiperidin-1-yl)but-2-en-1-one.
| Compound Name | 1-[3-(3-chloro-4-fluoroanilino)-8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6-tetraen-11-yl]-4-(2,6-dimethylpiperidin-1-yl)but-2-en-1-one |
|---|---|
| PubChem CID | 66877451 |
| Molecular Formula | C26H29ClFN5OS |
| Molecular Weight | 514.07 g/mol |
| Exact Mass | 513.18 |
| IUPAC Name | 1-[3-(3-chloro-4-fluoroanilino)-8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6-tetraen-11-yl]-4-(2,6-dimethylpiperidin-1-yl)but-2-en-1-one |
| SMILES | CC1CCCC(C)N1CC=CC(=O)N1CCc2c(sc3ncnc(Nc4ccc(F)c(Cl)c4)c23)C1 |
| InChI | InChI=1S/C26H29ClFN5OS/c1-16-5-3-6-17(2)33(16)11-4-7-23(34)32-12-10-19-22(14-32)35-26-24(19)25(29-15-30-26)31-18-8-9-21(28)20(27)13-18/h4,7-9,13,15-17H,3,5-6,10-12,14H2,1-2H3,(H,29,30,31) |
| InChIKey | BNWRLCLRFGYCIO-UHFFFAOYSA-N |
| XLogP | 5.93 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.07 |
| LogP ≤ 5 | 5.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|