C22H21ClFN5OS2 — CID 59586963
(E)-1-[3-(3-chloro-4-fluoroanilino)-8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6-tetraen-11-yl]-4-(1,3-thiazolidin-3-yl)but-2-en-1-one (PubChem CID 59586963) has the molecular formula C22H21ClFN5OS2 and a molecular weight of 490.03 g/mol. Its IUPAC name is (E)-1-[3-(3-chloro-4-fluoroanilino)-8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6-tetraen-11-yl]-4-(1,3-thiazolidin-3-yl)but-2-en-1-one.
| Compound Name | (E)-1-[3-(3-chloro-4-fluoroanilino)-8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6-tetraen-11-yl]-4-(1,3-thiazolidin-3-yl)but-2-en-1-one |
|---|---|
| PubChem CID | 59586963 |
| Molecular Formula | C22H21ClFN5OS2 |
| Molecular Weight | 490.03 g/mol |
| Exact Mass | 489.09 |
| IUPAC Name | (E)-1-[3-(3-chloro-4-fluoroanilino)-8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6-tetraen-11-yl]-4-(1,3-thiazolidin-3-yl)but-2-en-1-one |
| SMILES | O=C(/C=C/CN1CCSC1)N1CCc2c(sc3ncnc(Nc4ccc(F)c(Cl)c4)c23)C1 |
| InChI | InChI=1S/C22H21ClFN5OS2/c23-16-10-14(3-4-17(16)24)27-21-20-15-5-7-29(11-18(15)32-22(20)26-12-25-21)19(30)2-1-6-28-8-9-31-13-28/h1-4,10,12H,5-9,11,13H2,(H,25,26,27)/b2-1+ |
| InChIKey | WLVCOGLZDZDVLQ-OWOJBTEDSA-N |
| XLogP | 4.67 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.03 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|