C28H35ClFN7OS — CID 123229669
1-[3-(3-chloro-4-fluoroanilino)-8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6-tetraen-11-yl]-4-[4-[3-(dimethylamino)propyl]piperazin-1-yl]but-2-en-1-one (PubChem CID 123229669) has the molecular formula C28H35ClFN7OS and a molecular weight of 572.15 g/mol. Its IUPAC name is 1-[3-(3-chloro-4-fluoroanilino)-8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6-tetraen-11-yl]-4-[4-[3-(dimethylamino)propyl]piperazin-1-yl]but-2-en-1-one.
| Compound Name | 1-[3-(3-chloro-4-fluoroanilino)-8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6-tetraen-11-yl]-4-[4-[3-(dimethylamino)propyl]piperazin-1-yl]but-2-en-1-one |
|---|---|
| PubChem CID | 123229669 |
| Molecular Formula | C28H35ClFN7OS |
| Molecular Weight | 572.15 g/mol |
| Exact Mass | 571.23 |
| IUPAC Name | 1-[3-(3-chloro-4-fluoroanilino)-8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6-tetraen-11-yl]-4-[4-[3-(dimethylamino)propyl]piperazin-1-yl]but-2-en-1-one |
| SMILES | CN(C)CCCN1CCN(CC=CC(=O)N2CCc3c(sc4ncnc(Nc5ccc(F)c(Cl)c5)c34)C2)CC1 |
| InChI | InChI=1S/C28H35ClFN7OS/c1-34(2)9-4-11-36-15-13-35(14-16-36)10-3-5-25(38)37-12-8-21-24(18-37)39-28-26(21)27(31-19-32-28)33-20-6-7-23(30)22(29)17-20/h3,5-7,17,19H,4,8-16,18H2,1-2H3,(H,31,32,33) |
| InChIKey | NNVSBIYTVUNDEB-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 67.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.15 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|