C23H24ClFN4OS — CID 58774614
[4-(3-chloro-4-fluoroanilino)-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-7-yl]-(2,5-dimethylpyrrolidin-1-yl)methanone (PubChem CID 58774614) has the molecular formula C23H24ClFN4OS and a molecular weight of 458.99 g/mol. Its IUPAC name is [4-(3-chloro-4-fluoroanilino)-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-7-yl]-(2,5-dimethylpyrrolidin-1-yl)methanone.
| Compound Name | [4-(3-chloro-4-fluoroanilino)-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-7-yl]-(2,5-dimethylpyrrolidin-1-yl)methanone |
|---|---|
| PubChem CID | 58774614 |
| Molecular Formula | C23H24ClFN4OS |
| Molecular Weight | 458.99 g/mol |
| Exact Mass | 458.13 |
| IUPAC Name | [4-(3-chloro-4-fluoroanilino)-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-7-yl]-(2,5-dimethylpyrrolidin-1-yl)methanone |
| SMILES | CC1CCC(C)N1C(=O)C1CCc2c(sc3ncnc(Nc4ccc(F)c(Cl)c4)c23)C1 |
| InChI | InChI=1S/C23H24ClFN4OS/c1-12-3-4-13(2)29(12)23(30)14-5-7-16-19(9-14)31-22-20(16)21(26-11-27-22)28-15-6-8-18(25)17(24)10-15/h6,8,10-14H,3-5,7,9H2,1-2H3,(H,26,27,28) |
| InChIKey | RIVIKEFYFDRFHD-UHFFFAOYSA-N |
| XLogP | 5.73 |
| TPSA | 58.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.99 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |