C22H23N6O2S+ — CID 144847525
[2-amino-5-[[(7S)-7-(2-oxa-5-azabicyclo[2.1.1]hexane-5-carbonyl)-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-yl]amino]phenyl]methylideneazanium (PubChem CID 144847525) has the molecular formula C22H23N6O2S+ and a molecular weight of 435.53 g/mol. Its IUPAC name is [2-amino-5-[[(7S)-7-(2-oxa-5-azabicyclo[2.1.1]hexane-5-carbonyl)-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-yl]amino]phenyl]methylideneazanium.
| Compound Name | [2-amino-5-[[(7S)-7-(2-oxa-5-azabicyclo[2.1.1]hexane-5-carbonyl)-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-yl]amino]phenyl]methylideneazanium |
|---|---|
| PubChem CID | 144847525 |
| Molecular Formula | C22H23N6O2S+ |
| Molecular Weight | 435.53 g/mol |
| Exact Mass | 435.16 |
| IUPAC Name | [2-amino-5-[[(7S)-7-(2-oxa-5-azabicyclo[2.1.1]hexane-5-carbonyl)-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-yl]amino]phenyl]methylideneazanium |
| SMILES | Nc1ccc(Nc2ncnc3sc4c(c23)CC[C@H](C(=O)N2C3COC2C3)C4)cc1C=[NH2+] |
| InChI | InChI=1S/C22H22N6O2S/c23-8-12-5-13(2-4-16(12)24)27-20-19-15-3-1-11(6-17(15)31-21(19)26-10-25-20)22(29)28-14-7-18(28)30-9-14/h2,4-5,8,10-11,14,18,23H,1,3,6-7,9,24H2,(H,25,26,27)/p+1/t11-,14?,18?/m0/s1 |
| InChIKey | IVIUAYGBSLESAT-JCDGYTILSA-O |
| XLogP | 1.26 |
| TPSA | 118.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.53 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|