C25H26N6OS — CID 149053115
[4-(1H-isoindol-5-ylamino)-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-7-yl]-(5-methyl-2,5-diazabicyclo[2.2.1]heptan-2-yl)methanone (PubChem CID 149053115) has the molecular formula C25H26N6OS and a molecular weight of 458.59 g/mol. Its IUPAC name is [4-(1H-isoindol-5-ylamino)-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-7-yl]-(5-methyl-2,5-diazabicyclo[2.2.1]heptan-2-yl)methanone.
| Compound Name | [4-(1H-isoindol-5-ylamino)-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-7-yl]-(5-methyl-2,5-diazabicyclo[2.2.1]heptan-2-yl)methanone |
|---|---|
| PubChem CID | 149053115 |
| Molecular Formula | C25H26N6OS |
| Molecular Weight | 458.59 g/mol |
| Exact Mass | 458.19 |
| IUPAC Name | [4-(1H-isoindol-5-ylamino)-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-7-yl]-(5-methyl-2,5-diazabicyclo[2.2.1]heptan-2-yl)methanone |
| SMILES | CN1CC2CC1CN2C(=O)C1CCc2c(sc3ncnc(Nc4ccc5c(c4)C=NC5)c23)C1 |
| InChI | InChI=1S/C25H26N6OS/c1-30-11-19-8-18(30)12-31(19)25(32)14-3-5-20-21(7-14)33-24-22(20)23(27-13-28-24)29-17-4-2-15-9-26-10-16(15)6-17/h2,4,6,10,13-14,18-19H,3,5,7-9,11-12H2,1H3,(H,27,28,29) |
| InChIKey | QKEXHFQISMUNGA-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 73.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.59 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |