C23H24N6O2S — CID 160924959
[(3S)-3-methylmorpholin-4-yl]-[(7S)-4-(7H-pyrrolo[3,4-b]pyridin-3-ylamino)-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-7-yl]methanone (PubChem CID 160924959) has the molecular formula C23H24N6O2S and a molecular weight of 448.55 g/mol. Its IUPAC name is [(3S)-3-methylmorpholin-4-yl]-[(7S)-4-(7H-pyrrolo[3,4-b]pyridin-3-ylamino)-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-7-yl]methanone.
| Compound Name | [(3S)-3-methylmorpholin-4-yl]-[(7S)-4-(7H-pyrrolo[3,4-b]pyridin-3-ylamino)-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-7-yl]methanone |
|---|---|
| PubChem CID | 160924959 |
| Molecular Formula | C23H24N6O2S |
| Molecular Weight | 448.55 g/mol |
| Exact Mass | 448.17 |
| IUPAC Name | [(3S)-3-methylmorpholin-4-yl]-[(7S)-4-(7H-pyrrolo[3,4-b]pyridin-3-ylamino)-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-7-yl]methanone |
| SMILES | C[C@H]1COCCN1C(=O)[C@H]1CCc2c(sc3ncnc(Nc4cnc5c(c4)C=NC5)c23)C1 |
| InChI | InChI=1S/C23H24N6O2S/c1-13-11-31-5-4-29(13)23(30)14-2-3-17-19(7-14)32-22-20(17)21(26-12-27-22)28-16-6-15-8-24-10-18(15)25-9-16/h6,8-9,12-14H,2-5,7,10-11H2,1H3,(H,26,27,28)/t13-,14-/m0/s1 |
| InChIKey | BFRRJPAAEPIDTP-KBPBESRZSA-N |
| XLogP | 3.11 |
| TPSA | 92.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.55 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |