C22H24N6O2S2 — CID 123786190
[4-(2,3-dihydro-1,2,3-benzothiadiazol-6-ylamino)-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-7-yl]-(3-methylmorpholin-4-yl)methanone (PubChem CID 123786190) has the molecular formula C22H24N6O2S2 and a molecular weight of 468.61 g/mol. Its IUPAC name is [4-(2,3-dihydro-1,2,3-benzothiadiazol-6-ylamino)-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-7-yl]-(3-methylmorpholin-4-yl)methanone.
| Compound Name | [4-(2,3-dihydro-1,2,3-benzothiadiazol-6-ylamino)-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-7-yl]-(3-methylmorpholin-4-yl)methanone |
|---|---|
| PubChem CID | 123786190 |
| Molecular Formula | C22H24N6O2S2 |
| Molecular Weight | 468.61 g/mol |
| Exact Mass | 468.14 |
| IUPAC Name | [4-(2,3-dihydro-1,2,3-benzothiadiazol-6-ylamino)-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-7-yl]-(3-methylmorpholin-4-yl)methanone |
| SMILES | CC1COCCN1C(=O)C1CCc2c(sc3ncnc(Nc4ccc5c(c4)SNN5)c23)C1 |
| InChI | InChI=1S/C22H24N6O2S2/c1-12-10-30-7-6-28(12)22(29)13-2-4-15-17(8-13)31-21-19(15)20(23-11-24-21)25-14-3-5-16-18(9-14)32-27-26-16/h3,5,9,11-13,26-27H,2,4,6-8,10H2,1H3,(H,23,24,25) |
| InChIKey | KCJMWVRTICOCCH-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 91.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.61 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|