C21H22N6O2S2 — CID 123774399
[4-(2,3-dihydro-1,2,3-benzothiadiazol-6-ylamino)-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-7-yl]-morpholin-4-ylmethanone (PubChem CID 123774399) has the molecular formula C21H22N6O2S2 and a molecular weight of 454.58 g/mol. Its IUPAC name is [4-(2,3-dihydro-1,2,3-benzothiadiazol-6-ylamino)-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-7-yl]-morpholin-4-ylmethanone.
| Compound Name | [4-(2,3-dihydro-1,2,3-benzothiadiazol-6-ylamino)-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-7-yl]-morpholin-4-ylmethanone |
|---|---|
| PubChem CID | 123774399 |
| Molecular Formula | C21H22N6O2S2 |
| Molecular Weight | 454.58 g/mol |
| Exact Mass | 454.12 |
| IUPAC Name | [4-(2,3-dihydro-1,2,3-benzothiadiazol-6-ylamino)-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-7-yl]-morpholin-4-ylmethanone |
| SMILES | O=C(C1CCc2c(sc3ncnc(Nc4ccc5c(c4)SNN5)c23)C1)N1CCOCC1 |
| InChI | InChI=1S/C21H22N6O2S2/c28-21(27-5-7-29-8-6-27)12-1-3-14-16(9-12)30-20-18(14)19(22-11-23-20)24-13-2-4-15-17(10-13)31-26-25-15/h2,4,10-12,25-26H,1,3,5-9H2,(H,22,23,24) |
| InChIKey | NGTUNOISNJWRSR-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 91.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.58 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|