C18H17N5O3S2 — CID 144966939
(7S)-4-[(5-methoxy-2,3-dihydro-1,2,3-benzothiadiazol-6-yl)amino]-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidine-7-carboxylic acid (PubChem CID 144966939) has the molecular formula C18H17N5O3S2 and a molecular weight of 415.50 g/mol. Its IUPAC name is (7S)-4-[(5-methoxy-2,3-dihydro-1,2,3-benzothiadiazol-6-yl)amino]-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidine-7-carboxylic acid.
| Compound Name | (7S)-4-[(5-methoxy-2,3-dihydro-1,2,3-benzothiadiazol-6-yl)amino]-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidine-7-carboxylic acid |
|---|---|
| PubChem CID | 144966939 |
| Molecular Formula | C18H17N5O3S2 |
| Molecular Weight | 415.50 g/mol |
| Exact Mass | 415.08 |
| IUPAC Name | (7S)-4-[(5-methoxy-2,3-dihydro-1,2,3-benzothiadiazol-6-yl)amino]-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidine-7-carboxylic acid |
| SMILES | COc1cc2c(cc1Nc1ncnc3sc4c(c13)CC[C@H](C(=O)O)C4)SNN2 |
| InChI | InChI=1S/C18H17N5O3S2/c1-26-12-5-11-14(28-23-22-11)6-10(12)21-16-15-9-3-2-8(18(24)25)4-13(9)27-17(15)20-7-19-16/h5-8,22-23H,2-4H2,1H3,(H,24,25)(H,19,20,21)/t8-/m0/s1 |
| InChIKey | CVNCPZZNDZUVKS-QMMMGPOBSA-N |
| XLogP | 3.57 |
| TPSA | 108.40 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.50 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|