C20H21N5O3S2 — CID 144966900
ethyl (7S)-4-[(5-methoxy-2,3-dihydro-1,2,3-benzothiadiazol-6-yl)amino]-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidine-7-carboxylate (PubChem CID 144966900) has the molecular formula C20H21N5O3S2 and a molecular weight of 443.55 g/mol. Its IUPAC name is ethyl (7S)-4-[(5-methoxy-2,3-dihydro-1,2,3-benzothiadiazol-6-yl)amino]-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidine-7-carboxylate.
| Compound Name | ethyl (7S)-4-[(5-methoxy-2,3-dihydro-1,2,3-benzothiadiazol-6-yl)amino]-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidine-7-carboxylate |
|---|---|
| PubChem CID | 144966900 |
| Molecular Formula | C20H21N5O3S2 |
| Molecular Weight | 443.55 g/mol |
| Exact Mass | 443.11 |
| IUPAC Name | ethyl (7S)-4-[(5-methoxy-2,3-dihydro-1,2,3-benzothiadiazol-6-yl)amino]-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidine-7-carboxylate |
| SMILES | CCOC(=O)[C@H]1CCc2c(sc3ncnc(Nc4cc5c(cc4OC)NNS5)c23)C1 |
| InChI | InChI=1S/C20H21N5O3S2/c1-3-28-20(26)10-4-5-11-15(6-10)29-19-17(11)18(21-9-22-19)23-12-8-16-13(24-25-30-16)7-14(12)27-2/h7-10,24-25H,3-6H2,1-2H3,(H,21,22,23)/t10-/m0/s1 |
| InChIKey | KPTQIUJEMLVRIP-JTQLQIEISA-N |
| XLogP | 4.05 |
| TPSA | 97.40 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.55 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|