C24H24N4O4S2 — CID 160563456
ethyl (7S)-4-[(8-methyl-1,5-dioxospiro[2H-indolizine-3,3'-thietane]-6-yl)amino]-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidine-7-carboxylate (PubChem CID 160563456) has the molecular formula C24H24N4O4S2 and a molecular weight of 496.61 g/mol. Its IUPAC name is ethyl (7S)-4-[(8-methyl-1,5-dioxospiro[2H-indolizine-3,3'-thietane]-6-yl)amino]-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidine-7-carboxylate.
| Compound Name | ethyl (7S)-4-[(8-methyl-1,5-dioxospiro[2H-indolizine-3,3'-thietane]-6-yl)amino]-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidine-7-carboxylate |
|---|---|
| PubChem CID | 160563456 |
| Molecular Formula | C24H24N4O4S2 |
| Molecular Weight | 496.61 g/mol |
| Exact Mass | 496.12 |
| IUPAC Name | ethyl (7S)-4-[(8-methyl-1,5-dioxospiro[2H-indolizine-3,3'-thietane]-6-yl)amino]-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidine-7-carboxylate |
| SMILES | CCOC(=O)[C@H]1CCc2c(sc3ncnc(Nc4cc(C)c5n(c4=O)C4(CSC4)CC5=O)c23)C1 |
| InChI | InChI=1S/C24H24N4O4S2/c1-3-32-23(31)13-4-5-14-17(7-13)34-21-18(14)20(25-11-26-21)27-15-6-12(2)19-16(29)8-24(9-33-10-24)28(19)22(15)30/h6,11,13H,3-5,7-10H2,1-2H3,(H,25,26,27)/t13-/m0/s1 |
| InChIKey | QZPREVYBZRRVLU-ZDUSSCGKSA-N |
| XLogP | 3.60 |
| TPSA | 103.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.61 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |