C24H26N4O2S — CID 160527712
8-methyl-6-(5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-ylamino)spiro[2H-indolizine-3,1'-cyclohexane]-1,5-dione (PubChem CID 160527712) has the molecular formula C24H26N4O2S and a molecular weight of 434.57 g/mol. Its IUPAC name is 8-methyl-6-(5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-ylamino)spiro[2H-indolizine-3,1'-cyclohexane]-1,5-dione.
| Compound Name | 8-methyl-6-(5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-ylamino)spiro[2H-indolizine-3,1'-cyclohexane]-1,5-dione |
|---|---|
| PubChem CID | 160527712 |
| Molecular Formula | C24H26N4O2S |
| Molecular Weight | 434.57 g/mol |
| Exact Mass | 434.18 |
| IUPAC Name | 8-methyl-6-(5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-ylamino)spiro[2H-indolizine-3,1'-cyclohexane]-1,5-dione |
| SMILES | Cc1cc(Nc2ncnc3sc4c(c23)CCCC4)c(=O)n2c1C(=O)CC21CCCCC1 |
| InChI | InChI=1S/C24H26N4O2S/c1-14-11-16(23(30)28-20(14)17(29)12-24(28)9-5-2-6-10-24)27-21-19-15-7-3-4-8-18(15)31-22(19)26-13-25-21/h11,13H,2-10,12H2,1H3,(H,25,26,27) |
| InChIKey | QVCYTVKRLJCDGS-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 76.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.57 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |