C16H12Cl3N3S — CID 23794696
N-(2,4,5-trichlorophenyl)-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-amine (PubChem CID 23794696) has the molecular formula C16H12Cl3N3S and a molecular weight of 384.72 g/mol. Its IUPAC name is N-(2,4,5-trichlorophenyl)-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-amine.
| Compound Name | N-(2,4,5-trichlorophenyl)-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 23794696 |
| Molecular Formula | C16H12Cl3N3S |
| Molecular Weight | 384.72 g/mol |
| Exact Mass | 382.98 |
| IUPAC Name | N-(2,4,5-trichlorophenyl)-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-amine |
| SMILES | Clc1cc(Cl)c(Nc2ncnc3sc4c(c23)CCCC4)cc1Cl |
| InChI | InChI=1S/C16H12Cl3N3S/c17-9-5-11(19)12(6-10(9)18)22-15-14-8-3-1-2-4-13(8)23-16(14)21-7-20-15/h5-7H,1-4H2,(H,20,21,22) |
| InChIKey | WYBXUCIZQWPPKR-UHFFFAOYSA-N |
| XLogP | 6.27 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.72 |
| LogP ≤ 5 | 6.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|